C26H33NO3 — CID 91567241
methyl 2-benzyl-3-[4-[3-(1-hydroxyethenyl)phenyl]-3,4-dimethylpiperidin-1-yl]propanoate (PubChem CID 91567241) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is methyl 2-benzyl-3-[4-[3-(1-hydroxyethenyl)phenyl]-3,4-dimethylpiperidin-1-yl]propanoate.
| Compound Name | methyl 2-benzyl-3-[4-[3-(1-hydroxyethenyl)phenyl]-3,4-dimethylpiperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 91567241 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | methyl 2-benzyl-3-[4-[3-(1-hydroxyethenyl)phenyl]-3,4-dimethylpiperidin-1-yl]propanoate |
| SMILES | C=C(O)c1cccc(C2(C)CCN(CC(Cc3ccccc3)C(=O)OC)CC2C)c1 |
| InChI | InChI=1S/C26H33NO3/c1-19-17-27(18-23(25(29)30-4)15-21-9-6-5-7-10-21)14-13-26(19,3)24-12-8-11-22(16-24)20(2)28/h5-12,16,19,23,28H,2,13-15,17-18H2,1,3-4H3 |
| InChIKey | LIOJLIRJFGEGGO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|