C37H40N2O — CID 88936028
3-[[(4R)-4-[3-(benzhydrylideneamino)phenyl]-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one (PubChem CID 88936028) has the molecular formula C37H40N2O and a molecular weight of 528.74 g/mol. Its IUPAC name is 3-[[(4R)-4-[3-(benzhydrylideneamino)phenyl]-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one.
| Compound Name | 3-[[(4R)-4-[3-(benzhydrylideneamino)phenyl]-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 88936028 |
| Molecular Formula | C37H40N2O |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 3-[[(4R)-4-[3-(benzhydrylideneamino)phenyl]-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one |
| SMILES | CC(=O)C(Cc1ccccc1)CN1CC[C@@](C)(c2cccc(N=C(c3ccccc3)c3ccccc3)c2)C(C)C1 |
| InChI | InChI=1S/C37H40N2O/c1-28-26-39(27-33(29(2)40)24-30-14-7-4-8-15-30)23-22-37(28,3)34-20-13-21-35(25-34)38-36(31-16-9-5-10-17-31)32-18-11-6-12-19-32/h4-21,25,28,33H,22-24,26-27H2,1-3H3/t28?,33?,37-/m1/s1 |
| InChIKey | URKBKAXAMXVVJI-CPCWRMETSA-N |
| XLogP | 7.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|