C28H37NO2 — CID 91032344
1-[4-(3-acetylphenyl)-3,4-dimethylpiperidin-1-yl]-2-benzylhexan-3-one (PubChem CID 91032344) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-[4-(3-acetylphenyl)-3,4-dimethylpiperidin-1-yl]-2-benzylhexan-3-one.
| Compound Name | 1-[4-(3-acetylphenyl)-3,4-dimethylpiperidin-1-yl]-2-benzylhexan-3-one |
|---|---|
| PubChem CID | 91032344 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 1-[4-(3-acetylphenyl)-3,4-dimethylpiperidin-1-yl]-2-benzylhexan-3-one |
| SMILES | CCCC(=O)C(Cc1ccccc1)CN1CCC(C)(c2cccc(C(C)=O)c2)C(C)C1 |
| InChI | InChI=1S/C28H37NO2/c1-5-10-27(31)25(17-23-11-7-6-8-12-23)20-29-16-15-28(4,21(2)19-29)26-14-9-13-24(18-26)22(3)30/h6-9,11-14,18,21,25H,5,10,15-17,19-20H2,1-4H3 |
| InChIKey | YQXQSJKINVFCIF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |