C25H30F3NO4S — CID 59730481
[3-[(3R,4R)-1-[(2S)-2-benzyl-3-oxobutyl]-3,4-dimethylpiperidin-4-yl]phenyl] trifluoromethanesulfonate (PubChem CID 59730481) has the molecular formula C25H30F3NO4S and a molecular weight of 497.58 g/mol. Its IUPAC name is [3-[(3R,4R)-1-[(2S)-2-benzyl-3-oxobutyl]-3,4-dimethylpiperidin-4-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[(3R,4R)-1-[(2S)-2-benzyl-3-oxobutyl]-3,4-dimethylpiperidin-4-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59730481 |
| Molecular Formula | C25H30F3NO4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [3-[(3R,4R)-1-[(2S)-2-benzyl-3-oxobutyl]-3,4-dimethylpiperidin-4-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)[C@@H](Cc1ccccc1)CN1CC[C@@](C)(c2cccc(OS(=O)(=O)C(F)(F)F)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H30F3NO4S/c1-18-16-29(17-21(19(2)30)14-20-8-5-4-6-9-20)13-12-24(18,3)22-10-7-11-23(15-22)33-34(31,32)25(26,27)28/h4-11,15,18,21H,12-14,16-17H2,1-3H3/t18-,21-,24+/m0/s1 |
| InChIKey | AZRTVKJNQJWMLO-NSXLHWASSA-N |
| XLogP | 4.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|