About 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one
3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one (PubChem CID 21040159) has the molecular formula C25H33NO
and a molecular weight of 363.55 g/mol. Its IUPAC name is 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one.
Molecular Properties
| Compound Name | 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one |
| PubChem CID | 21040159 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one |
| SMILES | CC(=O)C(Cc1ccccc1)CN1CCC(C)(c2cccc(C)c2)C(C)C1 |
| InChI | InChI=1S/C25H33NO/c1-19-9-8-12-24(15-19)25(4)13-14-26(17-20(25)2)18-23(21(3)27)16-22-10-6-5-7-11-22/h5-12,15,20,23H,13-14,16-18H2,1-4H3 |
| InChIKey | QWMYJTBOMRMCAE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one?
The IUPAC name of 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one (CID 21040159) is 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one.
What is the SMILES notation for 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one?
The canonical SMILES for 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one is CC(=O)C(Cc1ccccc1)CN1CCC(C)(c2cccc(C)c2)C(C)C1.
What is the InChIKey of 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one?
The InChIKey is QWMYJTBOMRMCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO/c1-19-9-8-12-24(15-19)25(4)13-14-26(17-20(25)2)18-23(21(3)27)16-22-10-6-5-7-11-22/h5-12,15,20,23H,13-14,16-18H2,1-4H3.
What are the key properties of 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one?
3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one has a molecular weight of 363.55 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-[3,4-dimethyl-4-(3-methylphenyl)piperidin-1-yl]butan-2-one is sourced from PubChem (CID 21040159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).