C25H32N2O7S — CID 124784396
2-[[(2R)-2-benzyl-3-[(3S,4S)-3,4-dimethyl-4-(3-sulfooxyphenyl)piperidin-1-yl]propanoyl]amino]acetic acid (PubChem CID 124784396) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-[[(2R)-2-benzyl-3-[(3S,4S)-3,4-dimethyl-4-(3-sulfooxyphenyl)piperidin-1-yl]propanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-benzyl-3-[(3S,4S)-3,4-dimethyl-4-(3-sulfooxyphenyl)piperidin-1-yl]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 124784396 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 2-[[(2R)-2-benzyl-3-[(3S,4S)-3,4-dimethyl-4-(3-sulfooxyphenyl)piperidin-1-yl]propanoyl]amino]acetic acid |
| SMILES | C[C@@H]1CN(C[C@@H](Cc2ccccc2)C(=O)NCC(=O)O)CC[C@]1(C)c1cccc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C25H32N2O7S/c1-18-16-27(12-11-25(18,2)21-9-6-10-22(14-21)34-35(31,32)33)17-20(24(30)26-15-23(28)29)13-19-7-4-3-5-8-19/h3-10,14,18,20H,11-13,15-17H2,1-2H3,(H,26,30)(H,28,29)(H,31,32,33)/t18-,20-,25+/m1/s1 |
| InChIKey | IZTWKPHUSXWTDP-BSWQBHCVSA-N |
| XLogP | 2.53 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|