C24H32N2O — CID 76754485
3-[[4-(3-aminophenyl)-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one (PubChem CID 76754485) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-[[4-(3-aminophenyl)-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one.
| Compound Name | 3-[[4-(3-aminophenyl)-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 76754485 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-[[4-(3-aminophenyl)-3,4-dimethylpiperidin-1-yl]methyl]-4-phenylbutan-2-one |
| SMILES | CC(=O)C(Cc1ccccc1)CN1CCC(C)(c2cccc(N)c2)C(C)C1 |
| InChI | InChI=1S/C24H32N2O/c1-18-16-26(13-12-24(18,3)22-10-7-11-23(25)15-22)17-21(19(2)27)14-20-8-5-4-6-9-20/h4-11,15,18,21H,12-14,16-17,25H2,1-3H3 |
| InChIKey | DEKWGQJIWAATMK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|