C21H33NO4Si — CID 59730457
2-trimethylsilylethyl (3R,4R)-4-(3-methoxycarbonylphenyl)-3,4-dimethylpiperidine-1-carboxylate (PubChem CID 59730457) has the molecular formula C21H33NO4Si and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3R,4R)-4-(3-methoxycarbonylphenyl)-3,4-dimethylpiperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (3R,4R)-4-(3-methoxycarbonylphenyl)-3,4-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59730457 |
| Molecular Formula | C21H33NO4Si |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-trimethylsilylethyl (3R,4R)-4-(3-methoxycarbonylphenyl)-3,4-dimethylpiperidine-1-carboxylate |
| SMILES | COC(=O)c1cccc([C@]2(C)CCN(C(=O)OCC[Si](C)(C)C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C21H33NO4Si/c1-16-15-22(20(24)26-12-13-27(4,5)6)11-10-21(16,2)18-9-7-8-17(14-18)19(23)25-3/h7-9,14,16H,10-13,15H2,1-6H3/t16-,21+/m0/s1 |
| InChIKey | KFAONKARUHRLGI-HRAATJIYSA-N |
| XLogP | 4.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|