C26H42N2O3 — CID 91260920
3-[(3R,4S)-1-[3-(1-hydroxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 91260920) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is 3-[(3R,4S)-1-[3-(1-hydroxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[(3R,4S)-1-[3-(1-hydroxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91260920 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 3-[(3R,4S)-1-[3-(1-hydroxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc([C@@]2(C)CCN(CCCC3(O)CCCCC3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C26H42N2O3/c1-21-20-28(16-8-13-26(30)11-5-4-6-12-26)17-14-25(21,2)23-10-7-9-22(19-23)24(29)27-15-18-31-3/h7,9-10,19,21,30H,4-6,8,11-18,20H2,1-3H3,(H,27,29)/t21-,25-/m0/s1 |
| InChIKey | BFKNLWMEHHBENY-OFVILXPXSA-N |
| XLogP | 4.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|