C31H36N2O2 — CID 73241961
methyl 3-(2-benzyl-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl)benzoate (PubChem CID 73241961) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is methyl 3-(2-benzyl-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl)benzoate.
| Compound Name | methyl 3-(2-benzyl-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl)benzoate |
|---|---|
| PubChem CID | 73241961 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | methyl 3-(2-benzyl-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl)benzoate |
| SMILES | COC(=O)c1cccc(C2(C)CC3CN(Cc4ccccc4)C(c4ccccc4)CN3CC2C)c1 |
| InChI | InChI=1S/C31H36N2O2/c1-23-19-32-22-29(25-13-8-5-9-14-25)33(20-24-11-6-4-7-12-24)21-28(32)18-31(23,2)27-16-10-15-26(17-27)30(34)35-3/h4-17,23,28-29H,18-22H2,1-3H3 |
| InChIKey | WAWBXLWGGYKPAP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |