C20H25N3O2 — CID 66598906
methyl 3-amino-4-[(3R)-4-benzyl-3-methylpiperazin-1-yl]benzoate (PubChem CID 66598906) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is methyl 3-amino-4-[(3R)-4-benzyl-3-methylpiperazin-1-yl]benzoate.
| Compound Name | methyl 3-amino-4-[(3R)-4-benzyl-3-methylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 66598906 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | methyl 3-amino-4-[(3R)-4-benzyl-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(Cc3ccccc3)[C@H](C)C2)c(N)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-13-23(11-10-22(15)14-16-6-4-3-5-7-16)19-9-8-17(12-18(19)21)20(24)25-2/h3-9,12,15H,10-11,13-14,21H2,1-2H3/t15-/m1/s1 |
| InChIKey | NARFVUHXNWKERZ-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|