C21H28N4O2 — CID 100633265
3-amino-4-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)benzamide (PubChem CID 100633265) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-amino-4-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-amino-4-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 100633265 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 3-amino-4-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(N2CCN(Cc3ccccc3)CC2)c(N)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-27-14-9-23-21(26)18-7-8-20(19(22)15-18)25-12-10-24(11-13-25)16-17-5-3-2-4-6-17/h2-8,15H,9-14,16,22H2,1H3,(H,23,26) |
| InChIKey | WUUVFXAWGVULHK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|