C23H32FN5O — CID 68631283
3-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-[2-(2-fluorophenyl)ethyl]benzamide (PubChem CID 68631283) has the molecular formula C23H32FN5O and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-[2-(2-fluorophenyl)ethyl]benzamide.
| Compound Name | 3-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-[2-(2-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 68631283 |
| Molecular Formula | C23H32FN5O |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 3-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-[2-(2-fluorophenyl)ethyl]benzamide |
| SMILES | CN(C)CCN1CCN(c2ccc(C(=O)NCCc3ccccc3F)cc2N)CC1 |
| InChI | InChI=1S/C23H32FN5O/c1-27(2)11-12-28-13-15-29(16-14-28)22-8-7-19(17-21(22)25)23(30)26-10-9-18-5-3-4-6-20(18)24/h3-8,17H,9-16,25H2,1-2H3,(H,26,30) |
| InChIKey | UBVZISWSDBOBPN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|