C14H23FN4 — CID 62885742
4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluoroaniline (PubChem CID 62885742) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluoroaniline.
| Compound Name | 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluoroaniline |
|---|---|
| PubChem CID | 62885742 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluoroaniline |
| SMILES | CN(C)CCN1CCN(c2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C14H23FN4/c1-17(2)5-6-18-7-9-19(10-8-18)14-4-3-12(16)11-13(14)15/h3-4,11H,5-10,16H2,1-2H3 |
| InChIKey | URJZGSDVTQQVAF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|