C15H23ClN4S — CID 62890191
5-chloro-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]benzenecarbothioamide (PubChem CID 62890191) has the molecular formula C15H23ClN4S and a molecular weight of 326.90 g/mol. Its IUPAC name is 5-chloro-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 62890191 |
| Molecular Formula | C15H23ClN4S |
| Molecular Weight | 326.90 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-chloro-2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]benzenecarbothioamide |
| SMILES | CN(C)CCN1CCN(c2ccc(Cl)cc2C(N)=S)CC1 |
| InChI | InChI=1S/C15H23ClN4S/c1-18(2)5-6-19-7-9-20(10-8-19)14-4-3-12(16)11-13(14)15(17)21/h3-4,11H,5-10H2,1-2H3,(H2,17,21) |
| InChIKey | ICLSHHNZQVFYBW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.90 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|