C17H28FN3O2 — CID 23540092
2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 23540092) has the molecular formula C17H28FN3O2 and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 23540092 |
| Molecular Formula | C17H28FN3O2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | COCCOc1ccc(N2CCN(CCN(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C17H28FN3O2/c1-19(2)6-7-20-8-10-21(11-9-20)17-5-4-15(14-16(17)18)23-13-12-22-3/h4-5,14H,6-13H2,1-3H3 |
| InChIKey | RIMFQBHIYKXSJN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|