C28H32FN9O2 — CID 10302585
3-[2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-8-(2-methylphenyl)-[1,2,4]triazolo[5,1-f]purin-5-amine (PubChem CID 10302585) has the molecular formula C28H32FN9O2 and a molecular weight of 545.62 g/mol. Its IUPAC name is 3-[2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-8-(2-methylphenyl)-[1,2,4]triazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-8-(2-methylphenyl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 10302585 |
| Molecular Formula | C28H32FN9O2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 3-[2-[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-8-(2-methylphenyl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
| SMILES | COCCOc1ccc(N2CCN(CCn3cnc4c3nc(N)n3nc(-c5ccccc5C)nc43)CC2)c(F)c1 |
| InChI | InChI=1S/C28H32FN9O2/c1-19-5-3-4-6-21(19)25-32-27-24-26(33-28(30)38(27)34-25)37(18-31-24)14-11-35-9-12-36(13-10-35)23-8-7-20(17-22(23)29)40-16-15-39-2/h3-8,17-18H,9-16H2,1-2H3,(H2,30,33) |
| InChIKey | RXKAEPQZHNXVLJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|