C26H30N10O — CID 20605048
3-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]-8-pyridin-2-yl-[1,2,4]triazolo[5,1-f]purin-5-amine (PubChem CID 20605048) has the molecular formula C26H30N10O and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]-8-pyridin-2-yl-[1,2,4]triazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]-8-pyridin-2-yl-[1,2,4]triazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 20605048 |
| Molecular Formula | C26H30N10O |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]-8-pyridin-2-yl-[1,2,4]triazolo[5,1-f]purin-5-amine |
| SMILES | CCCOc1ccc(N2CCN(CCn3cnc4c3nc(N)n3nc(-c5ccccn5)nc43)CC2)cc1 |
| InChI | InChI=1S/C26H30N10O/c1-2-17-37-20-8-6-19(7-9-20)34-14-11-33(12-15-34)13-16-35-18-29-22-24(35)31-26(27)36-25(22)30-23(32-36)21-5-3-4-10-28-21/h3-10,18H,2,11-17H2,1H3,(H2,27,31) |
| InChIKey | IZDIDZHPQOHCKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|