C25H27N9O3 — CID 146468229
2-[4-[4-[2-[5-amino-8-(furan-2-yl)pyrazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]phenoxy]acetamide (PubChem CID 146468229) has the molecular formula C25H27N9O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is 2-[4-[4-[2-[5-amino-8-(furan-2-yl)pyrazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[4-[2-[5-amino-8-(furan-2-yl)pyrazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 146468229 |
| Molecular Formula | C25H27N9O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2-[4-[4-[2-[5-amino-8-(furan-2-yl)pyrazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(N2CCN(CCn3cnc4c3nc(N)n3nc(-c5ccco5)cc43)CC2)cc1 |
| InChI | InChI=1S/C25H27N9O3/c26-22(35)15-37-18-5-3-17(4-6-18)32-10-7-31(8-11-32)9-12-33-16-28-23-20-14-19(21-2-1-13-36-21)30-34(20)25(27)29-24(23)33/h1-6,13-14,16H,7-12,15H2,(H2,26,35)(H2,27,29) |
| InChIKey | XIPNBVFZIHEOOF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 145.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|