C27H30FN9O2S — CID 146468415
3-[2-[4-[2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine (PubChem CID 146468415) has the molecular formula C27H30FN9O2S and a molecular weight of 563.66 g/mol. Its IUPAC name is 3-[2-[4-[2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-[2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 146468415 |
| Molecular Formula | C27H30FN9O2S |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 3-[2-[4-[2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3ccc(N4CCS(=O)CC4)cc3F)CC2)c2cc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H30FN9O2S/c28-20-16-19(34-11-14-40(38)15-12-34)3-4-22(20)35-8-5-33(6-9-35)7-10-36-18-30-25-23-17-21(24-2-1-13-39-24)32-37(23)27(29)31-26(25)36/h1-4,13,16-18H,5-12,14-15H2,(H2,29,31) |
| InChIKey | MPBZCDFRCHJIHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|