C26H28F2N10O2S — CID 146467567
3-[2-[4-[2,4-difluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine (PubChem CID 146467567) has the molecular formula C26H28F2N10O2S and a molecular weight of 582.64 g/mol. Its IUPAC name is 3-[2-[4-[2,4-difluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-[2,4-difluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 146467567 |
| Molecular Formula | C26H28F2N10O2S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 3-[2-[4-[2,4-difluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3cc(N4CCS(=O)CC4)c(F)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C26H28F2N10O2S/c27-17-14-18(28)20(36-9-12-41(39)13-10-36)15-19(17)35-6-3-34(4-7-35)5-8-37-16-30-22-24(37)32-26(29)38-25(22)31-23(33-38)21-2-1-11-40-21/h1-2,11,14-16H,3-10,12-13H2,(H2,29,32) |
| InChIKey | CLNOVLPDCFPGLH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |