C26H28FN9O4 — CID 146468445
4-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid (PubChem CID 146468445) has the molecular formula C26H28FN9O4 and a molecular weight of 549.57 g/mol. Its IUPAC name is 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid.
| Compound Name | 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 146468445 |
| Molecular Formula | C26H28FN9O4 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3ccc(OCCCC(=O)O)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C26H28FN9O4/c27-18-15-17(39-13-2-4-21(37)38)5-6-19(18)34-10-7-33(8-11-34)9-12-35-16-29-22-24(35)31-26(28)36-25(22)30-23(32-36)20-3-1-14-40-20/h1,3,5-6,14-16H,2,4,7-13H2,(H2,28,31)(H,37,38) |
| InChIKey | OTBQOSQSJMVGEX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 153.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|