C26H29FN8O3S — CID 146467631
3-[2-[4-[2-fluoro-4-(2-methylsulfinylethoxy)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine (PubChem CID 146467631) has the molecular formula C26H29FN8O3S and a molecular weight of 552.64 g/mol. Its IUPAC name is 3-[2-[4-[2-fluoro-4-(2-methylsulfinylethoxy)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-[2-fluoro-4-(2-methylsulfinylethoxy)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 146467631 |
| Molecular Formula | C26H29FN8O3S |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 3-[2-[4-[2-fluoro-4-(2-methylsulfinylethoxy)phenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)pyrazolo[5,1-f]purin-5-amine |
| SMILES | CS(=O)CCOc1ccc(N2CCN(CCn3cnc4c3nc(N)n3nc(-c5ccco5)cc43)CC2)c(F)c1 |
| InChI | InChI=1S/C26H29FN8O3S/c1-39(36)14-13-37-18-4-5-21(19(27)15-18)33-9-6-32(7-10-33)8-11-34-17-29-24-22-16-20(23-3-2-12-38-23)31-35(22)26(28)30-25(24)34/h2-5,12,15-17H,6-11,13-14H2,1H3,(H2,28,30) |
| InChIKey | HGVNERCDFPGJNB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|