C25H25F4N9O3 — CID 146468253
3-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 146468253) has the molecular formula C25H25F4N9O3 and a molecular weight of 575.53 g/mol. Its IUPAC name is 3-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 146468253 |
| Molecular Formula | C25H25F4N9O3 |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 3-[4-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3ccc(OCC(O)C(F)(F)F)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H25F4N9O3/c26-16-12-15(41-13-19(39)25(27,28)29)3-4-17(16)36-8-5-35(6-9-36)7-10-37-14-31-20-22(37)33-24(30)38-23(20)32-21(34-38)18-2-1-11-40-18/h1-4,11-12,14,19,39H,5-10,13H2,(H2,30,33) |
| InChIKey | SPSQOVUZHYKDEK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|