C25H27FN10O2 — CID 146467663
3-[2-[4-[4-(azetidin-3-yloxy)-2-fluorophenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine (PubChem CID 146467663) has the molecular formula C25H27FN10O2 and a molecular weight of 518.56 g/mol. Its IUPAC name is 3-[2-[4-[4-(azetidin-3-yloxy)-2-fluorophenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine.
| Compound Name | 3-[2-[4-[4-(azetidin-3-yloxy)-2-fluorophenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
|---|---|
| PubChem CID | 146467663 |
| Molecular Formula | C25H27FN10O2 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 3-[2-[4-[4-(azetidin-3-yloxy)-2-fluorophenyl]piperazin-1-yl]ethyl]-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-5-amine |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3ccc(OC4CNC4)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H27FN10O2/c26-18-12-16(38-17-13-28-14-17)3-4-19(18)34-8-5-33(6-9-34)7-10-35-15-29-21-23(35)31-25(27)36-24(21)30-22(32-36)20-2-1-11-37-20/h1-4,11-12,15,17,28H,5-10,13-14H2,(H2,27,31) |
| InChIKey | KZMCRJYIXVXGSD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|