C25H27F2N9O4 — CID 146467577
3-[5-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol (PubChem CID 146467577) has the molecular formula C25H27F2N9O4 and a molecular weight of 555.55 g/mol. Its IUPAC name is 3-[5-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol.
| Compound Name | 3-[5-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 146467577 |
| Molecular Formula | C25H27F2N9O4 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 3-[5-[4-[2-[5-amino-8-(furan-2-yl)-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
| SMILES | Nc1nc2c(ncn2CCN2CCN(c3cc(OCC(O)CO)c(F)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H27F2N9O4/c26-16-10-17(27)20(40-13-15(38)12-37)11-18(16)34-6-3-33(4-7-34)5-8-35-14-29-21-23(35)31-25(28)36-24(21)30-22(32-36)19-2-1-9-39-19/h1-2,9-11,14-15,37-38H,3-8,12-13H2,(H2,28,31) |
| InChIKey | QDHGTYUASDBUMV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |