C23H27F2N9O4 — CID 146468632
(2S)-3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol (PubChem CID 146468632) has the molecular formula C23H27F2N9O4 and a molecular weight of 531.52 g/mol. Its IUPAC name is (2S)-3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 146468632 |
| Molecular Formula | C23H27F2N9O4 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (2S)-3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
| SMILES | Nc1nc(NCCN2CCN(c3cc(OC[C@@H](O)CO)c(F)cc3F)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H27F2N9O4/c24-15-10-16(25)19(38-13-14(36)12-35)11-17(15)33-7-5-32(6-8-33)4-3-27-22-29-21(26)34-23(30-22)28-20(31-34)18-2-1-9-37-18/h1-2,9-11,14,35-36H,3-8,12-13H2,(H3,26,27,28,29,30,31)/t14-/m0/s1 |
| InChIKey | SIVZONZLRBPMTF-AWEZNQCLSA-N |
| XLogP | 0.61 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |