C24H28F2N10O4 — CID 146468363
5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-(2,3-dihydroxypropyl)-2,4-difluorobenzamide (PubChem CID 146468363) has the molecular formula C24H28F2N10O4 and a molecular weight of 558.55 g/mol. Its IUPAC name is 5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-(2,3-dihydroxypropyl)-2,4-difluorobenzamide.
| Compound Name | 5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-(2,3-dihydroxypropyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 146468363 |
| Molecular Formula | C24H28F2N10O4 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-(2,3-dihydroxypropyl)-2,4-difluorobenzamide |
| SMILES | Nc1nc(NCCN2CCN(c3cc(C(=O)NCC(O)CO)c(F)cc3F)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H28F2N10O4/c25-16-11-17(26)18(10-15(16)21(39)29-12-14(38)13-37)35-7-5-34(6-8-35)4-3-28-23-31-22(27)36-24(32-23)30-20(33-36)19-2-1-9-40-19/h1-2,9-11,14,37-38H,3-8,12-13H2,(H,29,39)(H3,27,28,30,31,32,33) |
| InChIKey | SJJBKVJBEZIZMS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 183.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |