C25H32FN11O2 — CID 146467833
4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide (PubChem CID 146467833) has the molecular formula C25H32FN11O2 and a molecular weight of 537.60 g/mol. Its IUPAC name is 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide.
| Compound Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 146467833 |
| Molecular Formula | C25H32FN11O2 |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(N2CCN(CCNc3nc(N)n4nc(-c5ccco5)nc4n3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H32FN11O2/c1-34(2)9-7-28-22(38)17-5-6-19(18(26)16-17)36-13-11-35(12-14-36)10-8-29-24-31-23(27)37-25(32-24)30-21(33-37)20-4-3-15-39-20/h3-6,15-16H,7-14H2,1-2H3,(H,28,38)(H3,27,29,30,31,32,33) |
| InChIKey | BDXAURGFSPLTOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |