C26H34FN11O2 — CID 146467572
4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide (PubChem CID 146467572) has the molecular formula C26H34FN11O2 and a molecular weight of 551.63 g/mol. Its IUPAC name is 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide.
| Compound Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 146467572 |
| Molecular Formula | C26H34FN11O2 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-N-[2-(dimethylamino)ethyl]-3-fluorobenzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(N2CCN(CCN(C)c3nc(N)n4nc(-c5ccco5)nc4n3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H34FN11O2/c1-34(2)9-8-29-23(39)18-6-7-20(19(27)17-18)37-14-12-36(13-15-37)11-10-35(3)25-31-24(28)38-26(32-25)30-22(33-38)21-5-4-16-40-21/h4-7,16-17H,8-15H2,1-3H3,(H,29,39)(H2,28,30,31,32,33) |
| InChIKey | HWJVBIKGSQQCCA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |