C25H30FN9O4 — CID 146468743
2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluorophenoxy]-2-methylpropanoic acid (PubChem CID 146468743) has the molecular formula C25H30FN9O4 and a molecular weight of 539.57 g/mol. Its IUPAC name is 2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluorophenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluorophenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146468743 |
| Molecular Formula | C25H30FN9O4 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluorophenoxy]-2-methylpropanoic acid |
| SMILES | CN(CCN1CCN(c2ccc(OC(C)(C)C(=O)O)cc2F)CC1)c1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C25H30FN9O4/c1-25(2,21(36)37)39-16-6-7-18(17(26)15-16)34-12-10-33(11-13-34)9-8-32(3)23-29-22(27)35-24(30-23)28-20(31-35)19-5-4-14-38-19/h4-7,14-15H,8-13H2,1-3H3,(H,36,37)(H2,27,28,29,30,31) |
| InChIKey | IVBFABJNEREUKL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 151.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|