C25H32FN11O3 — CID 146467243
2-[2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl-methylamino]acetamide (PubChem CID 146467243) has the molecular formula C25H32FN11O3 and a molecular weight of 553.60 g/mol. Its IUPAC name is 2-[2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl-methylamino]acetamide.
| Compound Name | 2-[2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 146467243 |
| Molecular Formula | C25H32FN11O3 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 2-[2-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl-methylamino]acetamide |
| SMILES | CN(CCOc1ccc(N2CCN(CCNc3nc(N)n4nc(-c5ccco5)nc4n3)CC2)c(F)c1)CC(N)=O |
| InChI | InChI=1S/C25H32FN11O3/c1-34(16-21(27)38)12-14-39-17-4-5-19(18(26)15-17)36-10-8-35(9-11-36)7-6-29-24-31-23(28)37-25(32-24)30-22(33-37)20-3-2-13-40-20/h2-5,13,15H,6-12,14,16H2,1H3,(H2,27,38)(H3,28,29,30,31,32,33) |
| InChIKey | QUIHKRABBUKFFG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|