C24H28FN9O4 — CID 146468404
4-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid (PubChem CID 146468404) has the molecular formula C24H28FN9O4 and a molecular weight of 525.55 g/mol. Its IUPAC name is 4-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid.
| Compound Name | 4-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 146468404 |
| Molecular Formula | C24H28FN9O4 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 4-[4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
| SMILES | Nc1nc(NCCN2CCN(c3ccc(OCCCC(=O)O)cc3F)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H28FN9O4/c25-17-15-16(37-13-2-4-20(35)36)5-6-18(17)33-11-9-32(10-12-33)8-7-27-23-29-22(26)34-24(30-23)28-21(31-34)19-3-1-14-38-19/h1,3,5-6,14-15H,2,4,7-13H2,(H,35,36)(H3,26,27,28,29,30,31) |
| InChIKey | QICPLNFGZJWFOU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 160.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|