C27H30FN9O5 — CID 146468414
4-[4-[4-[2-[5-amino-8-(furan-2-yl)-1-methyl-2-oxo-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid (PubChem CID 146468414) has the molecular formula C27H30FN9O5 and a molecular weight of 579.59 g/mol. Its IUPAC name is 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-1-methyl-2-oxo-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid.
| Compound Name | 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-1-methyl-2-oxo-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 146468414 |
| Molecular Formula | C27H30FN9O5 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 4-[4-[4-[2-[5-amino-8-(furan-2-yl)-1-methyl-2-oxo-[1,2,4]triazolo[5,1-f]purin-3-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]butanoic acid |
| SMILES | Cn1c(=O)n(CCN2CCN(c3ccc(OCCCC(=O)O)cc3F)CC2)c2nc(N)n3nc(-c4ccco4)nc3c21 |
| InChI | InChI=1S/C27H30FN9O5/c1-33-22-24(31-26(29)37-25(22)30-23(32-37)20-4-2-15-42-20)36(27(33)40)13-10-34-8-11-35(12-9-34)19-7-6-17(16-18(19)28)41-14-3-5-21(38)39/h2,4,6-7,15-16H,3,5,8-14H2,1H3,(H2,29,31)(H,38,39) |
| InChIKey | NYEIDDQPGSZEDG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|