C26H34FN11O3 — CID 146467370
4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide (PubChem CID 146467370) has the molecular formula C26H34FN11O3 and a molecular weight of 567.63 g/mol. Its IUPAC name is 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide.
| Compound Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 146467370 |
| Molecular Formula | C26H34FN11O3 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 4-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide |
| SMILES | CN(CCN1CCN(c2ccc(C(=O)NCCNCCO)cc2F)CC1)c1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C26H34FN11O3/c1-35(25-32-24(28)38-26(33-25)31-22(34-38)21-3-2-16-41-21)9-10-36-11-13-37(14-12-36)20-5-4-18(17-19(20)27)23(40)30-7-6-29-8-15-39/h2-5,16-17,29,39H,6-15H2,1H3,(H,30,40)(H2,28,31,32,33,34) |
| InChIKey | KQTIWBKXYRMUSK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 166.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|