C28H32FN9O4S — CID 146468649
4-[4-[2-[8-amino-11-(furan-2-yl)-4-oxo-3-thia-5,7,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),7,10-tetraen-5-yl]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide (PubChem CID 146468649) has the molecular formula C28H32FN9O4S and a molecular weight of 609.69 g/mol. Its IUPAC name is 4-[4-[2-[8-amino-11-(furan-2-yl)-4-oxo-3-thia-5,7,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),7,10-tetraen-5-yl]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide.
| Compound Name | 4-[4-[2-[8-amino-11-(furan-2-yl)-4-oxo-3-thia-5,7,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),7,10-tetraen-5-yl]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 146468649 |
| Molecular Formula | C28H32FN9O4S |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 4-[4-[2-[8-amino-11-(furan-2-yl)-4-oxo-3-thia-5,7,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),7,10-tetraen-5-yl]ethyl]piperazin-1-yl]-3-fluoro-N-[2-(2-hydroxyethylamino)ethyl]benzamide |
| SMILES | Nc1nc2c(sc(=O)n2CCN2CCN(c3ccc(C(=O)NCCNCCO)cc3F)CC2)c2cc(-c3ccco3)nn12 |
| InChI | InChI=1S/C28H32FN9O4S/c29-19-16-18(26(40)32-6-5-31-7-14-39)3-4-21(19)36-11-8-35(9-12-36)10-13-37-25-24(43-28(37)41)22-17-20(23-2-1-15-42-23)34-38(22)27(30)33-25/h1-4,15-17,31,39H,5-14H2,(H2,30,33)(H,32,40) |
| InChIKey | GUDUXAAGLZEUPD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|