C24H29F2N9O4 — CID 146467965
3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol (PubChem CID 146467965) has the molecular formula C24H29F2N9O4 and a molecular weight of 545.55 g/mol. Its IUPAC name is 3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol.
| Compound Name | 3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 146467965 |
| Molecular Formula | C24H29F2N9O4 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 3-[5-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-methylamino]ethyl]piperazin-1-yl]-2,4-difluorophenoxy]propane-1,2-diol |
| SMILES | CN(CCN1CCN(c2cc(OCC(O)CO)c(F)cc2F)CC1)c1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C24H29F2N9O4/c1-32(23-29-22(27)35-24(30-23)28-21(31-35)19-3-2-10-38-19)4-5-33-6-8-34(9-7-33)18-12-20(17(26)11-16(18)25)39-14-15(37)13-36/h2-3,10-12,15,36-37H,4-9,13-14H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | BSBZBGLURSAIJD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 154.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |