C26H32F2N8O3S — CID 146468645
2-N-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)-2-N-methylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine (PubChem CID 146468645) has the molecular formula C26H32F2N8O3S and a molecular weight of 574.66 g/mol. Its IUPAC name is 2-N-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)-2-N-methylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine.
| Compound Name | 2-N-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)-2-N-methylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
|---|---|
| PubChem CID | 146468645 |
| Molecular Formula | C26H32F2N8O3S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 2-N-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)-2-N-methylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
| SMILES | CN(CCN1CCN(c2cc(OCCCS(C)=O)c(F)cc2F)CC1)c1nc(N)n2nc(-c3ccco3)cc2n1 |
| InChI | InChI=1S/C26H32F2N8O3S/c1-33(26-30-24-16-20(22-5-3-12-38-22)32-36(24)25(29)31-26)6-7-34-8-10-35(11-9-34)21-17-23(19(28)15-18(21)27)39-13-4-14-40(2)37/h3,5,12,15-17H,4,6-11,13-14H2,1-2H3,(H2,29,30,31) |
| InChIKey | MQLHXQSBSUOODF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|