C26H28F2N8O4S2 — CID 135346849
7-amino-10-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one (PubChem CID 135346849) has the molecular formula C26H28F2N8O4S2 and a molecular weight of 618.69 g/mol. Its IUPAC name is 7-amino-10-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one.
| Compound Name | 7-amino-10-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
|---|---|
| PubChem CID | 135346849 |
| Molecular Formula | C26H28F2N8O4S2 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 7-amino-10-[2-[4-[2,4-difluoro-5-(3-methylsulfinylpropoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
| SMILES | CS(=O)CCCOc1cc(N2CCN(CCn3c(=O)sc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c(F)cc1F |
| InChI | InChI=1S/C26H28F2N8O4S2/c1-42(38)13-3-12-40-20-15-18(16(27)14-17(20)28)34-8-5-33(6-9-34)7-10-35-23-21(41-26(35)37)24-30-22(19-4-2-11-39-19)32-36(24)25(29)31-23/h2,4,11,14-15H,3,5-10,12-13H2,1H3,(H2,29,31) |
| InChIKey | UNPZXHRBUXEVAI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|