C27H29FN8O3S2 — CID 146510333
7-amino-10-[2-[4-[2-fluoro-4-(thian-4-yloxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one (PubChem CID 146510333) has the molecular formula C27H29FN8O3S2 and a molecular weight of 596.71 g/mol. Its IUPAC name is 7-amino-10-[2-[4-[2-fluoro-4-(thian-4-yloxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one.
| Compound Name | 7-amino-10-[2-[4-[2-fluoro-4-(thian-4-yloxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
|---|---|
| PubChem CID | 146510333 |
| Molecular Formula | C27H29FN8O3S2 |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | 7-amino-10-[2-[4-[2-fluoro-4-(thian-4-yloxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
| SMILES | Nc1nc2c(sc(=O)n2CCN2CCN(c3ccc(OC4CCSCC4)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H29FN8O3S2/c28-19-16-18(39-17-5-14-40-15-6-17)3-4-20(19)34-10-7-33(8-11-34)9-12-35-24-22(41-27(35)37)25-30-23(21-2-1-13-38-21)32-36(25)26(29)31-24/h1-4,13,16-17H,5-12,14-15H2,(H2,29,31) |
| InChIKey | VFFNGSDPQZZIHN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|