C28H33FN10O3S — CID 139465499
7-amino-10-[2-[4-[2-fluoro-4-(2-piperazin-1-ylethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one (PubChem CID 139465499) has the molecular formula C28H33FN10O3S and a molecular weight of 608.70 g/mol. Its IUPAC name is 7-amino-10-[2-[4-[2-fluoro-4-(2-piperazin-1-ylethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one.
| Compound Name | 7-amino-10-[2-[4-[2-fluoro-4-(2-piperazin-1-ylethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
|---|---|
| PubChem CID | 139465499 |
| Molecular Formula | C28H33FN10O3S |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 7-amino-10-[2-[4-[2-fluoro-4-(2-piperazin-1-ylethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
| SMILES | Nc1nc2c(sc(=O)n2CCN2CCN(c3ccc(OCCN4CCNCC4)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C28H33FN10O3S/c29-20-18-19(41-17-15-35-7-5-31-6-8-35)3-4-21(20)37-12-9-36(10-13-37)11-14-38-25-23(43-28(38)40)26-32-24(22-2-1-16-42-22)34-39(26)27(30)33-25/h1-4,16,18,31H,5-15,17H2,(H2,30,33) |
| InChIKey | ZLVAYPSKGBSSAT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|