C26H26FN11O3S — CID 135346795
7-amino-10-[2-[4-[2-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one (PubChem CID 135346795) has the molecular formula C26H26FN11O3S and a molecular weight of 591.63 g/mol. Its IUPAC name is 7-amino-10-[2-[4-[2-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one.
| Compound Name | 7-amino-10-[2-[4-[2-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
|---|---|
| PubChem CID | 135346795 |
| Molecular Formula | C26H26FN11O3S |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 7-amino-10-[2-[4-[2-fluoro-4-[(1-methyl-1,2,4-triazol-3-yl)methoxy]phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
| SMILES | Cn1cnc(COc2ccc(N3CCN(CCn4c(=O)sc5c4nc(N)n4nc(-c6ccco6)nc54)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C26H26FN11O3S/c1-34-15-29-20(32-34)14-41-16-4-5-18(17(27)13-16)36-9-6-35(7-10-36)8-11-37-23-21(42-26(37)39)24-30-22(19-3-2-12-40-19)33-38(24)25(28)31-23/h2-5,12-13,15H,6-11,14H2,1H3,(H2,28,31) |
| InChIKey | MEMMPPJROMHTBP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 150.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|