C25H30F2N8O3S — CID 146467601
2-N-[2-[4-[2,4-difluoro-5-[3-[(S)-methylsulfinyl]propoxy]phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine (PubChem CID 146467601) has the molecular formula C25H30F2N8O3S and a molecular weight of 560.63 g/mol. Its IUPAC name is 2-N-[2-[4-[2,4-difluoro-5-[3-[(S)-methylsulfinyl]propoxy]phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine.
| Compound Name | 2-N-[2-[4-[2,4-difluoro-5-[3-[(S)-methylsulfinyl]propoxy]phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
|---|---|
| PubChem CID | 146467601 |
| Molecular Formula | C25H30F2N8O3S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-N-[2-[4-[2,4-difluoro-5-[3-[(S)-methylsulfinyl]propoxy]phenyl]piperazin-1-yl]ethyl]-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
| SMILES | C[S@](=O)CCCOc1cc(N2CCN(CCNc3nc(N)n4nc(-c5ccco5)cc4n3)CC2)c(F)cc1F |
| InChI | InChI=1S/C25H30F2N8O3S/c1-39(36)13-3-12-38-22-16-20(17(26)14-18(22)27)34-9-7-33(8-10-34)6-5-29-25-30-23-15-19(21-4-2-11-37-21)32-35(23)24(28)31-25/h2,4,11,14-16H,3,5-10,12-13H2,1H3,(H3,28,29,30,31)/t39-/m0/s1 |
| InChIKey | ZKFUKSWEWYLHOW-KDXMTYKHSA-N |
| XLogP | 2.63 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|