C25H30F2N9O2S+ — CID 158747799
5-N-[2-[4-[2,4-difluoro-5-(1-hydroxythian-1-ium-4-yl)phenyl]piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 158747799) has the molecular formula C25H30F2N9O2S+ and a molecular weight of 558.64 g/mol. Its IUPAC name is 5-N-[2-[4-[2,4-difluoro-5-(1-hydroxythian-1-ium-4-yl)phenyl]piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-[2-[4-[2,4-difluoro-5-(1-hydroxythian-1-ium-4-yl)phenyl]piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 158747799 |
| Molecular Formula | C25H30F2N9O2S+ |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 5-N-[2-[4-[2,4-difluoro-5-(1-hydroxythian-1-ium-4-yl)phenyl]piperazin-1-yl]ethyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NCCN2CCN(c3cc(C4CC[S+](O)CC4)c(F)cc3F)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C25H30F2N9O2S/c26-18-15-19(27)20(14-17(18)16-3-12-39(37)13-4-16)35-9-7-34(8-10-35)6-5-29-24-31-23(28)36-25(32-24)30-22(33-36)21-2-1-11-38-21/h1-2,11,14-16,37H,3-10,12-13H2,(H3,28,29,30,31,32,33)/q+1 |
| InChIKey | JMFAQXAWNDNOBN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|