C15H24FN5O — CID 58861072
N'-[4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluorophenyl]-N-hydroxymethanimidamide (PubChem CID 58861072) has the molecular formula C15H24FN5O and a molecular weight of 309.39 g/mol. Its IUPAC name is N'-[4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluorophenyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluorophenyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 58861072 |
| Molecular Formula | C15H24FN5O |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N'-[4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-3-fluorophenyl]-N-hydroxymethanimidamide |
| SMILES | CN(C)CCN1CCN(c2ccc(/N=C/NO)cc2F)CC1 |
| InChI | InChI=1S/C15H24FN5O/c1-19(2)5-6-20-7-9-21(10-8-20)15-4-3-13(11-14(15)16)17-12-18-22/h3-4,11-12,22H,5-10H2,1-2H3,(H,17,18) |
| InChIKey | HIQOURNNWPXTBV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|