C24H32N2O2 — CID 22966008
2-[3-[(3R,4S)-1-benzyl-3,4-dimethylpiperidin-4-yl]phenoxy]-2-methylpropanamide (PubChem CID 22966008) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[3-[(3R,4S)-1-benzyl-3,4-dimethylpiperidin-4-yl]phenoxy]-2-methylpropanamide.
| Compound Name | 2-[3-[(3R,4S)-1-benzyl-3,4-dimethylpiperidin-4-yl]phenoxy]-2-methylpropanamide |
|---|---|
| PubChem CID | 22966008 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-[3-[(3R,4S)-1-benzyl-3,4-dimethylpiperidin-4-yl]phenoxy]-2-methylpropanamide |
| SMILES | C[C@H]1CN(Cc2ccccc2)CC[C@]1(C)c1cccc(OC(C)(C)C(N)=O)c1 |
| InChI | InChI=1S/C24H32N2O2/c1-18-16-26(17-19-9-6-5-7-10-19)14-13-24(18,4)20-11-8-12-21(15-20)28-23(2,3)22(25)27/h5-12,15,18H,13-14,16-17H2,1-4H3,(H2,25,27)/t18-,24-/m0/s1 |
| InChIKey | KESIWDZLRPPDPR-UUOWRZLLSA-N |
| XLogP | 4.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |