C28H43N3O2 — CID 70106584
6-butyl-N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-2,3,3a,4,4a,5,7,8-octahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide (PubChem CID 70106584) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is 6-butyl-N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-2,3,3a,4,4a,5,7,8-octahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide.
| Compound Name | 6-butyl-N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-2,3,3a,4,4a,5,7,8-octahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 70106584 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | 6-butyl-N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-2,3,3a,4,4a,5,7,8-octahydro-1H-pyrrolo[2,3-g]isoquinoline-2-carboxamide |
| SMILES | CCCCN1CCC2(c3cccc(OC)c3)C=C3NC(C(=O)N(CC)CC)C(C)C3CC2C1 |
| InChI | InChI=1S/C28H43N3O2/c1-6-9-14-30-15-13-28(21-11-10-12-23(16-21)33-5)18-25-24(17-22(28)19-30)20(4)26(29-25)27(32)31(7-2)8-3/h10-12,16,18,20,22,24,26,29H,6-9,13-15,17,19H2,1-5H3 |
| InChIKey | HPGCYMLEYWZOJI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |