C24H36ClN3O2 — CID 70106166
N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-1,2,3,3a,4,4a,5,6,7,8-decahydropyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride (PubChem CID 70106166) has the molecular formula C24H36ClN3O2 and a molecular weight of 434.02 g/mol. Its IUPAC name is N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-1,2,3,3a,4,4a,5,6,7,8-decahydropyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride.
| Compound Name | N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-1,2,3,3a,4,4a,5,6,7,8-decahydropyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70106166 |
| Molecular Formula | C24H36ClN3O2 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N,N-diethyl-8a-(3-methoxyphenyl)-3-methyl-1,2,3,3a,4,4a,5,6,7,8-decahydropyrrolo[2,3-g]isoquinoline-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)C(=O)C1NC2=CC3(c4cccc(OC)c4)CCNCC3CC2C1C.Cl |
| InChI | InChI=1S/C24H35N3O2.ClH/c1-5-27(6-2)23(28)22-16(3)20-13-18-15-25-11-10-24(18,14-21(20)26-22)17-8-7-9-19(12-17)29-4;/h7-9,12,14,16,18,20,22,25-26H,5-6,10-11,13,15H2,1-4H3;1H |
| InChIKey | CTNMBTHSXITYSA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |