C17H26NO+ — CID 12838432
3a-(3-methoxyphenyl)-1,1-dimethyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-ium (PubChem CID 12838432) has the molecular formula C17H26NO+ and a molecular weight of 260.40 g/mol. Its IUPAC name is 3a-(3-methoxyphenyl)-1,1-dimethyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-ium.
| Compound Name | 3a-(3-methoxyphenyl)-1,1-dimethyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-ium |
|---|---|
| PubChem CID | 12838432 |
| Molecular Formula | C17H26NO+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3a-(3-methoxyphenyl)-1,1-dimethyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-ium |
| SMILES | COc1cccc(C23CCCCC2[N+](C)(C)CC3)c1 |
| InChI | InChI=1S/C17H26NO/c1-18(2)12-11-17(10-5-4-9-16(17)18)14-7-6-8-15(13-14)19-3/h6-8,13,16H,4-5,9-12H2,1-3H3/q+1 |
| InChIKey | UNVGUPKKDPYGFX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|