C14H18N2O — CID 132918335
(1S,9R,12R)-4-methoxy-8,10-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2(7),3,5-triene (PubChem CID 132918335) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (1S,9R,12R)-4-methoxy-8,10-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2(7),3,5-triene.
| Compound Name | (1S,9R,12R)-4-methoxy-8,10-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 132918335 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (1S,9R,12R)-4-methoxy-8,10-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCC[C@H]1CN[C@@H]3N2 |
| InChI | InChI=1S/C14H18N2O/c1-17-10-4-5-12-11(7-10)14-6-2-3-9(14)8-15-13(14)16-12/h4-5,7,9,13,15-16H,2-3,6,8H2,1H3/t9-,13+,14-/m0/s1 |
| InChIKey | YGXILJLTZGTSGF-FZZIBODNSA-N |
| XLogP | 2.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|